C13H20BrN — CID 114979558
1-(3-bromo-5-methylphenyl)-N-propylpropan-1-amine (PubChem CID 114979558) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is 1-(3-bromo-5-methylphenyl)-N-propylpropan-1-amine.
| Compound Name | 1-(3-bromo-5-methylphenyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 114979558 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-(3-bromo-5-methylphenyl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C13H20BrN/c1-4-6-15-13(5-2)11-7-10(3)8-12(14)9-11/h7-9,13,15H,4-6H2,1-3H3 |
| InChIKey | SYLKQDXHWMIDEP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |