C16H16BrClO — CID 114980844
1-(4-bromo-3-chlorophenyl)-2-(4-ethylphenyl)ethanol (PubChem CID 114980844) has the molecular formula C16H16BrClO and a molecular weight of 339.66 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-2-(4-ethylphenyl)ethanol.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-2-(4-ethylphenyl)ethanol |
|---|---|
| PubChem CID | 114980844 |
| Molecular Formula | C16H16BrClO |
| Molecular Weight | 339.66 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-2-(4-ethylphenyl)ethanol |
| SMILES | CCc1ccc(CC(O)c2ccc(Br)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H16BrClO/c1-2-11-3-5-12(6-4-11)9-16(19)13-7-8-14(17)15(18)10-13/h3-8,10,16,19H,2,9H2,1H3 |
| InChIKey | KWWDVKPUILQOFL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |