C14H19BrClN — CID 114981468
1-(3-bromo-2-chlorophenyl)-1-cyclohexyl-N-methylmethanamine (PubChem CID 114981468) has the molecular formula C14H19BrClN and a molecular weight of 316.67 g/mol. Its IUPAC name is 1-(3-bromo-2-chlorophenyl)-1-cyclohexyl-N-methylmethanamine.
| Compound Name | 1-(3-bromo-2-chlorophenyl)-1-cyclohexyl-N-methylmethanamine |
|---|---|
| PubChem CID | 114981468 |
| Molecular Formula | C14H19BrClN |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-(3-bromo-2-chlorophenyl)-1-cyclohexyl-N-methylmethanamine |
| SMILES | CNC(c1cccc(Br)c1Cl)C1CCCCC1 |
| InChI | InChI=1S/C14H19BrClN/c1-17-14(10-6-3-2-4-7-10)11-8-5-9-12(15)13(11)16/h5,8-10,14,17H,2-4,6-7H2,1H3 |
| InChIKey | PBQLNHYRSXWURH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |