C10H16O2 — CID 114982407
1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-one (PubChem CID 114982407) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-one.
| Compound Name | 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 114982407 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C10H16O2/c1-5-9(11)10-6(2)7(3)12-8(10)4/h5-8,10H,1H2,2-4H3 |
| InChIKey | FERUPOFLFYWAMF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|