C35H58O8Si — CID 11498272
[(2R,3R,6R)-2,6-dimethyl-2-[(1R)-2-[(1R,3S,8R,11S,13R,16Z)-14-oxo-2,7,12-trioxatricyclo[9.7.0.03,8]octadeca-9,16-dien-13-yl]-1-tri(propan-2-yl)silyloxyethyl]oxan-3-yl] acetate (PubChem CID 11498272) has the molecular formula C35H58O8Si and a molecular weight of 634.93 g/mol. Its IUPAC name is [(2R,3R,6R)-2,6-dimethyl-2-[(1R)-2-[(1R,3S,8R,11S,13R,16Z)-14-oxo-2,7,12-trioxatricyclo[9.7.0.03,8]octadeca-9,16-dien-13-yl]-1-tri(propan-2-yl)silyloxyethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,6R)-2,6-dimethyl-2-[(1R)-2-[(1R,3S,8R,11S,13R,16Z)-14-oxo-2,7,12-trioxatricyclo[9.7.0.03,8]octadeca-9,16-dien-13-yl]-1-tri(propan-2-yl)silyloxyethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11498272 |
| Molecular Formula | C35H58O8Si |
| Molecular Weight | 634.93 g/mol |
| Exact Mass | 634.39 |
| IUPAC Name | [(2R,3R,6R)-2,6-dimethyl-2-[(1R)-2-[(1R,3S,8R,11S,13R,16Z)-14-oxo-2,7,12-trioxatricyclo[9.7.0.03,8]octadeca-9,16-dien-13-yl]-1-tri(propan-2-yl)silyloxyethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@H](C)O[C@@]1(C)[C@@H](C[C@H]1O[C@H]2C=C[C@H]3OCCC[C@@H]3O[C@@H]2C/C=C\CC1=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H58O8Si/c1-22(2)44(23(3)4,24(5)6)43-34(35(9)33(39-26(8)36)19-16-25(7)42-35)21-32-27(37)13-10-11-14-30-31(41-32)18-17-28-29(40-30)15-12-20-38-28/h10-11,17-18,22-25,28-34H,12-16,19-21H2,1-9H3/b11-10-/t25-,28-,29+,30-,31+,32-,33-,34-,35-/m1/s1 |
| InChIKey | HNBQCEDTYZGCNQ-RDBLDJCGSA-N |
| XLogP | 7.00 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.93 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|