C24H5BF15- — CID 11498398
tris(2,3,4,5,6-pentafluorophenyl)-phenylboranuide (PubChem CID 11498398) has the molecular formula C24H5BF15- and a molecular weight of 589.09 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-phenylboranuide.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-phenylboranuide |
|---|---|
| PubChem CID | 11498398 |
| Molecular Formula | C24H5BF15- |
| Molecular Weight | 589.09 g/mol |
| Exact Mass | 589.03 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-phenylboranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2ccccc2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24H5BF15/c26-10-7(11(27)17(33)22(38)16(10)32)25(6-4-2-1-3-5-6,8-12(28)18(34)23(39)19(35)13(8)29)9-14(30)20(36)24(40)21(37)15(9)31/h1-5H/q-1 |
| InChIKey | JYXJDRZFOMOCMD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.09 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|