C35H43NO12 — CID 11498425
[2-oxo-1-phenyl-2-[[(2S,3R,4R,5S,6R)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]amino]ethyl] 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 11498425) has the molecular formula C35H43NO12 and a molecular weight of 669.72 g/mol. Its IUPAC name is [2-oxo-1-phenyl-2-[[(2S,3R,4R,5S,6R)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]amino]ethyl] 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | [2-oxo-1-phenyl-2-[[(2S,3R,4R,5S,6R)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]amino]ethyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 11498425 |
| Molecular Formula | C35H43NO12 |
| Molecular Weight | 669.72 g/mol |
| Exact Mass | 669.28 |
| IUPAC Name | [2-oxo-1-phenyl-2-[[(2S,3R,4R,5S,6R)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]amino]ethyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](NC(=O)C(OC(=O)C(C)c2ccc(CC(C)C)cc2)c2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C35H43NO12/c1-19(2)17-25-13-15-26(16-14-25)20(3)34(42)48-30(27-11-9-8-10-12-27)33(41)36-29-32(45-23(6)39)31(44-22(5)38)28(18-43-21(4)37)47-35(29)46-24(7)40/h8-16,19-20,28-32,35H,17-18H2,1-7H3,(H,36,41)/t20?,28-,29-,30?,31-,32-,35-/m1/s1 |
| InChIKey | FYEZXUYXHBLFQM-RAAOZNQCSA-N |
| XLogP | 3.47 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.72 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|