C15H18N2O2 — CID 114984670
[2-(3,4-dihydro-1H-isochromen-1-yl)-1-(furan-3-yl)ethyl]hydrazine (PubChem CID 114984670) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is [2-(3,4-dihydro-1H-isochromen-1-yl)-1-(furan-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3,4-dihydro-1H-isochromen-1-yl)-1-(furan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114984670 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [2-(3,4-dihydro-1H-isochromen-1-yl)-1-(furan-3-yl)ethyl]hydrazine |
| SMILES | NNC(CC1OCCc2ccccc21)c1ccoc1 |
| InChI | InChI=1S/C15H18N2O2/c16-17-14(12-5-7-18-10-12)9-15-13-4-2-1-3-11(13)6-8-19-15/h1-5,7,10,14-15,17H,6,8-9,16H2 |
| InChIKey | JQQMGKMGXGVQLE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|