C11H18BrN3O3 — CID 114986022
4-bromo-2-(2-hydroxyethyl)-5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]pyridazin-3-one (PubChem CID 114986022) has the molecular formula C11H18BrN3O3 and a molecular weight of 320.19 g/mol. Its IUPAC name is 4-bromo-2-(2-hydroxyethyl)-5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-hydroxyethyl)-5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114986022 |
| Molecular Formula | C11H18BrN3O3 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 4-bromo-2-(2-hydroxyethyl)-5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]pyridazin-3-one |
| SMILES | CC(C)[C@@H](CO)Nc1cnn(CCO)c(=O)c1Br |
| InChI | InChI=1S/C11H18BrN3O3/c1-7(2)9(6-17)14-8-5-13-15(3-4-16)11(18)10(8)12/h5,7,9,14,16-17H,3-4,6H2,1-2H3/t9-/m1/s1 |
| InChIKey | RWOZQWAIYOFPGN-SECBINFHSA-N |
| XLogP | 0.43 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |