C13H19NO2 — CID 114986964
(2R)-2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]propan-1-ol (PubChem CID 114986964) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2R)-2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]propan-1-ol.
| Compound Name | (2R)-2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 114986964 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2R)-2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]propan-1-ol |
| SMILES | COc1ccc2c(c1)C(N[C@H](C)CO)CC2 |
| InChI | InChI=1S/C13H19NO2/c1-9(8-15)14-13-6-4-10-3-5-11(16-2)7-12(10)13/h3,5,7,9,13-15H,4,6,8H2,1-2H3/t9-,13?/m1/s1 |
| InChIKey | UGQFXZQVWQBFPU-CGCSKFHYSA-N |
| XLogP | 1.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |