C9H19NO3S — CID 114987227
(2R)-2-[(2-methylsulfonylcyclopentyl)amino]propan-1-ol (PubChem CID 114987227) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is (2R)-2-[(2-methylsulfonylcyclopentyl)amino]propan-1-ol.
| Compound Name | (2R)-2-[(2-methylsulfonylcyclopentyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 114987227 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (2R)-2-[(2-methylsulfonylcyclopentyl)amino]propan-1-ol |
| SMILES | C[C@H](CO)NC1CCCC1S(C)(=O)=O |
| InChI | InChI=1S/C9H19NO3S/c1-7(6-11)10-8-4-3-5-9(8)14(2,12)13/h7-11H,3-6H2,1-2H3/t7-,8?,9?/m1/s1 |
| InChIKey | SOFHVIDGRMDOOY-AFPNSQJFSA-N |
| XLogP | -0.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |