C12H18N2S — CID 114987412
N-[cyclopenten-1-yl(1,3-thiazol-4-yl)methyl]propan-1-amine (PubChem CID 114987412) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is N-[cyclopenten-1-yl(1,3-thiazol-4-yl)methyl]propan-1-amine.
| Compound Name | N-[cyclopenten-1-yl(1,3-thiazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114987412 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-[cyclopenten-1-yl(1,3-thiazol-4-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCC1)c1cscn1 |
| InChI | InChI=1S/C12H18N2S/c1-2-7-13-12(10-5-3-4-6-10)11-8-15-9-14-11/h5,8-9,12-13H,2-4,6-7H2,1H3 |
| InChIKey | BYNFKOJKQXFRFE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|