C12H10N2O2 — CID 114988074
2,3-dihydro-1-benzofuran-5-yl(1H-pyrazol-5-yl)methanone (PubChem CID 114988074) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-5-yl(1H-pyrazol-5-yl)methanone.
| Compound Name | 2,3-dihydro-1-benzofuran-5-yl(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 114988074 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-5-yl(1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCO2)c1ccn[nH]1 |
| InChI | InChI=1S/C12H10N2O2/c15-12(10-3-5-13-14-10)9-1-2-11-8(7-9)4-6-16-11/h1-3,5,7H,4,6H2,(H,13,14) |
| InChIKey | GMPMMNIOJGZXGH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |