C9H10N2OS — CID 114988227
(3-methylthiophen-2-yl)-(1H-pyrazol-5-yl)methanol (PubChem CID 114988227) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is (3-methylthiophen-2-yl)-(1H-pyrazol-5-yl)methanol.
| Compound Name | (3-methylthiophen-2-yl)-(1H-pyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 114988227 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (3-methylthiophen-2-yl)-(1H-pyrazol-5-yl)methanol |
| SMILES | Cc1ccsc1C(O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H10N2OS/c1-6-3-5-13-9(6)8(12)7-2-4-10-11-7/h2-5,8,12H,1H3,(H,10,11) |
| InChIKey | GAQDKZBOGAJURZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |