C13H24O3 — CID 114988575
2-cyclopentyloxy-2,5-dimethylhexanoic acid (PubChem CID 114988575) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-cyclopentyloxy-2,5-dimethylhexanoic acid.
| Compound Name | 2-cyclopentyloxy-2,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 114988575 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-cyclopentyloxy-2,5-dimethylhexanoic acid |
| SMILES | CC(C)CCC(C)(OC1CCCC1)C(=O)O |
| InChI | InChI=1S/C13H24O3/c1-10(2)8-9-13(3,12(14)15)16-11-6-4-5-7-11/h10-11H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | JBLYXPYZZNTMTR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |