C12H13ClN2 — CID 114988756
5-[chloro-(3,4-dimethylphenyl)methyl]-1H-pyrazole (PubChem CID 114988756) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 5-[chloro-(3,4-dimethylphenyl)methyl]-1H-pyrazole.
| Compound Name | 5-[chloro-(3,4-dimethylphenyl)methyl]-1H-pyrazole |
|---|---|
| PubChem CID | 114988756 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-[chloro-(3,4-dimethylphenyl)methyl]-1H-pyrazole |
| SMILES | Cc1ccc(C(Cl)c2ccn[nH]2)cc1C |
| InChI | InChI=1S/C12H13ClN2/c1-8-3-4-10(7-9(8)2)12(13)11-5-6-14-15-11/h3-7,12H,1-2H3,(H,14,15) |
| InChIKey | DLLGCISKVPPZJA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|