C13H17N3O2 — CID 114989561
2-[(5-ethyl-2-oxo-1,3-dihydroindol-3-yl)amino]propanamide (PubChem CID 114989561) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-[(5-ethyl-2-oxo-1,3-dihydroindol-3-yl)amino]propanamide.
| Compound Name | 2-[(5-ethyl-2-oxo-1,3-dihydroindol-3-yl)amino]propanamide |
|---|---|
| PubChem CID | 114989561 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-[(5-ethyl-2-oxo-1,3-dihydroindol-3-yl)amino]propanamide |
| SMILES | CCc1ccc2c(c1)C(NC(C)C(N)=O)C(=O)N2 |
| InChI | InChI=1S/C13H17N3O2/c1-3-8-4-5-10-9(6-8)11(13(18)16-10)15-7(2)12(14)17/h4-7,11,15H,3H2,1-2H3,(H2,14,17)(H,16,18) |
| InChIKey | QHOWMGJTLAKAHI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |