C4H9NO2 — CID 11499204
(3R,4R)-pyrrolidine-3,4-diol (PubChem CID 11499204) has the molecular formula C4H9NO2 and a molecular weight of 103.12 g/mol. Its IUPAC name is (3R,4R)-pyrrolidine-3,4-diol.
| Compound Name | (3R,4R)-pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 11499204 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | (3R,4R)-pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C4H9NO2/c6-3-1-5-2-4(3)7/h3-7H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | JCZPOYAMKJFOLA-QWWZWVQMSA-N |
| XLogP | -1.69 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |