About 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine
2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine (PubChem CID 114992436) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine |
| PubChem CID | 114992436 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine |
| SMILES | CCCC(C)N(C)C(C)(CN)Cc1ccccc1 |
| InChI | InChI=1S/C16H28N2/c1-5-9-14(2)18(4)16(3,13-17)12-15-10-7-6-8-11-15/h6-8,10-11,14H,5,9,12-13,17H2,1-4H3 |
| InChIKey | HESDNYBWUQWIEN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine?
The IUPAC name of 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine (CID 114992436) is 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine.
What is the SMILES notation for 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine?
The canonical SMILES for 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine is CCCC(C)N(C)C(C)(CN)Cc1ccccc1.
What is the InChIKey of 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine?
The InChIKey is HESDNYBWUQWIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2/c1-5-9-14(2)18(4)16(3,13-17)12-15-10-7-6-8-11-15/h6-8,10-11,14H,5,9,12-13,17H2,1-4H3.
What are the key properties of 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine?
2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine has a molecular weight of 248.41 g/mol, XLogP of 3.07, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-dimethyl-2-N-pentan-2-yl-3-phenylpropane-1,2-diamine is sourced from PubChem (CID 114992436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).