C8H15NO2 — CID 11499317
(2S,3S)-1-butyl-3-methylaziridine-2-carboxylic acid (PubChem CID 11499317) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (2S,3S)-1-butyl-3-methylaziridine-2-carboxylic acid.
| Compound Name | (2S,3S)-1-butyl-3-methylaziridine-2-carboxylic acid |
|---|---|
| PubChem CID | 11499317 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (2S,3S)-1-butyl-3-methylaziridine-2-carboxylic acid |
| SMILES | CCCCN1[C@H](C(=O)O)[C@@H]1C |
| InChI | InChI=1S/C8H15NO2/c1-3-4-5-9-6(2)7(9)8(10)11/h6-7H,3-5H2,1-2H3,(H,10,11)/t6-,7-,9?/m0/s1 |
| InChIKey | SRJXXJXNFGDTJM-ASLNEKEESA-N |
| XLogP | 0.94 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|