About methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate
methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate (PubChem CID 11499325) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate |
| PubChem CID | 11499325 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate |
| SMILES | COC(=O)Cc1nc(C2CC2)no1 |
| InChI | InChI=1S/C8H10N2O3/c1-12-7(11)4-6-9-8(10-13-6)5-2-3-5/h5H,2-4H2,1H3 |
| InChIKey | SIJNKEZWEDUMGM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate?
The IUPAC name of methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate (CID 11499325) is methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate.
What is the SMILES notation for methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate?
The canonical SMILES for methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate is COC(=O)Cc1nc(C2CC2)no1.
What is the InChIKey of methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate?
The InChIKey is SIJNKEZWEDUMGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-12-7(11)4-6-9-8(10-13-6)5-2-3-5/h5H,2-4H2,1H3.
What are the key properties of methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate?
methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate has a molecular weight of 182.18 g/mol, XLogP of 0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetate is sourced from PubChem (CID 11499325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).