About 1-pyridin-3-yl-1,5-diazocane
1-pyridin-3-yl-1,5-diazocane (PubChem CID 11499356) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-pyridin-3-yl-1,5-diazocane.
Molecular Properties
| Compound Name | 1-pyridin-3-yl-1,5-diazocane |
| PubChem CID | 11499356 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-pyridin-3-yl-1,5-diazocane |
| SMILES | c1cncc(N2CCCNCCC2)c1 |
| InChI | InChI=1S/C11H17N3/c1-4-11(10-13-5-1)14-8-2-6-12-7-3-9-14/h1,4-5,10,12H,2-3,6-9H2 |
| InChIKey | APYCQWZCHZQKRW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyridin-3-yl-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-3-yl-1,5-diazocane?
The IUPAC name of 1-pyridin-3-yl-1,5-diazocane (CID 11499356) is 1-pyridin-3-yl-1,5-diazocane.
What is the SMILES notation for 1-pyridin-3-yl-1,5-diazocane?
The canonical SMILES for 1-pyridin-3-yl-1,5-diazocane is c1cncc(N2CCCNCCC2)c1.
What is the InChIKey of 1-pyridin-3-yl-1,5-diazocane?
The InChIKey is APYCQWZCHZQKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-4-11(10-13-5-1)14-8-2-6-12-7-3-9-14/h1,4-5,10,12H,2-3,6-9H2.
What are the key properties of 1-pyridin-3-yl-1,5-diazocane?
1-pyridin-3-yl-1,5-diazocane has a molecular weight of 191.28 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-3-yl-1,5-diazocane is sourced from PubChem (CID 11499356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).