C13H18O2 — CID 11499430
(1R,3R,7S,8S,11R)-11-hydroxy-6,8-dimethyltricyclo[5.3.1.03,8]undec-5-en-2-one (PubChem CID 11499430) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1R,3R,7S,8S,11R)-11-hydroxy-6,8-dimethyltricyclo[5.3.1.03,8]undec-5-en-2-one.
| Compound Name | (1R,3R,7S,8S,11R)-11-hydroxy-6,8-dimethyltricyclo[5.3.1.03,8]undec-5-en-2-one |
|---|---|
| PubChem CID | 11499430 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1R,3R,7S,8S,11R)-11-hydroxy-6,8-dimethyltricyclo[5.3.1.03,8]undec-5-en-2-one |
| SMILES | CC1=CC[C@H]2C(=O)[C@@H]3CC[C@@]2(C)[C@H]1[C@H]3O |
| InChI | InChI=1S/C13H18O2/c1-7-3-4-9-11(14)8-5-6-13(9,2)10(7)12(8)15/h3,8-10,12,15H,4-6H2,1-2H3/t8-,9-,10+,12-,13+/m0/s1 |
| InChIKey | HIAXKPZYQNQGNH-VKISENBKSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|