About 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide
2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide (PubChem CID 11499450) has the molecular formula C9H11N3O3
and a molecular weight of 209.20 g/mol. Its IUPAC name is 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide |
| PubChem CID | 11499450 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide |
| SMILES | CC1(C)COC(=O)/C1=N/NC(=O)CC#N |
| InChI | InChI=1S/C9H11N3O3/c1-9(2)5-15-8(14)7(9)12-11-6(13)3-4-10/h3,5H2,1-2H3,(H,11,13)/b12-7- |
| InChIKey | YWFOHXQKTMBOMQ-GHXNOFRVSA-N |
| XLogP | -0.04 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide?
The IUPAC name of 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide (CID 11499450) is 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide.
What is the SMILES notation for 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide?
The canonical SMILES for 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide is CC1(C)COC(=O)/C1=N/NC(=O)CC#N.
What is the InChIKey of 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide?
The InChIKey is YWFOHXQKTMBOMQ-GHXNOFRVSA-N. The full InChI is InChI=1S/C9H11N3O3/c1-9(2)5-15-8(14)7(9)12-11-6(13)3-4-10/h3,5H2,1-2H3,(H,11,13)/b12-7-.
What are the key properties of 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide?
2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide has a molecular weight of 209.20 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(E)-(4,4-dimethyl-2-oxooxolan-3-ylidene)amino]acetamide is sourced from PubChem (CID 11499450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).