C9H17NO3S — CID 11499525
(7S,8R,9S,9aR)-9a-methyl-3,4,6,7,8,9-hexahydro-1H-pyrido[2,1-c][1,4]thiazine-7,8,9-triol (PubChem CID 11499525) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is (7S,8R,9S,9aR)-9a-methyl-3,4,6,7,8,9-hexahydro-1H-pyrido[2,1-c][1,4]thiazine-7,8,9-triol.
| Compound Name | (7S,8R,9S,9aR)-9a-methyl-3,4,6,7,8,9-hexahydro-1H-pyrido[2,1-c][1,4]thiazine-7,8,9-triol |
|---|---|
| PubChem CID | 11499525 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (7S,8R,9S,9aR)-9a-methyl-3,4,6,7,8,9-hexahydro-1H-pyrido[2,1-c][1,4]thiazine-7,8,9-triol |
| SMILES | C[C@@]12CSCCN1C[C@H](O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C9H17NO3S/c1-9-5-14-3-2-10(9)4-6(11)7(12)8(9)13/h6-8,11-13H,2-5H2,1H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | PDFQPIWPEIIIGW-KDXUFGMBSA-N |
| XLogP | -1.11 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |