C7H12F4N2O — CID 114995945
3-(2,2,3,3-tetrafluoropropoxy)butanimidamide (PubChem CID 114995945) has the molecular formula C7H12F4N2O and a molecular weight of 216.18 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropoxy)butanimidamide.
| Compound Name | 3-(2,2,3,3-tetrafluoropropoxy)butanimidamide |
|---|---|
| PubChem CID | 114995945 |
| Molecular Formula | C7H12F4N2O |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropoxy)butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H12F4N2O/c1-4(2-5(12)13)14-3-7(10,11)6(8)9/h4,6H,2-3H2,1H3,(H3,12,13) |
| InChIKey | LYXZTSOPWIGCIF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|