C11H22N4 — CID 114996140
4-N-(6-methylheptan-2-yl)-1H-pyrazole-4,5-diamine (PubChem CID 114996140) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-N-(6-methylheptan-2-yl)-1H-pyrazole-4,5-diamine.
| Compound Name | 4-N-(6-methylheptan-2-yl)-1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 114996140 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 4-N-(6-methylheptan-2-yl)-1H-pyrazole-4,5-diamine |
| SMILES | CC(C)CCCC(C)Nc1cn[nH]c1N |
| InChI | InChI=1S/C11H22N4/c1-8(2)5-4-6-9(3)14-10-7-13-15-11(10)12/h7-9,14H,4-6H2,1-3H3,(H3,12,13,15) |
| InChIKey | XXBHAADRRABPER-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |