4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid

C14H16O4 — CID 114996160

IUPAC4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid
SMILESCC=CCOC1(C(=O)O)CCOc2ccccc21
InChIInChI=1S/C14H16O4/c1-2-3-9-18-14(13(15)16)8-10-17-12-7-5-4-6-11(12)14/h2-7H,8-10H2,1H3,(H,15,16)
InChIKeyOVXUATOWJHGACE-UHFFFAOYSA-N
MW248.28 g/mol
LogP2.34
Rot. Bonds4

About 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid

4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid (PubChem CID 114996160) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid.

Molecular Properties

Compound Name4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid
PubChem CID114996160
Molecular FormulaC14H16O4
Molecular Weight248.28 g/mol
Exact Mass248.10
IUPAC Name4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid
SMILESCC=CCOC1(C(=O)O)CCOc2ccccc21
InChIInChI=1S/C14H16O4/c1-2-3-9-18-14(13(15)16)8-10-17-12-7-5-4-6-11(12)14/h2-7H,8-10H2,1H3,(H,15,16)
InChIKeyOVXUATOWJHGACE-UHFFFAOYSA-N
XLogP2.34
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.28
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid?
The IUPAC name of 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid (CID 114996160) is 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid.
What is the SMILES notation for 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid?
The canonical SMILES for 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid is CC=CCOC1(C(=O)O)CCOc2ccccc21.
What is the InChIKey of 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid?
The InChIKey is OVXUATOWJHGACE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4/c1-2-3-9-18-14(13(15)16)8-10-17-12-7-5-4-6-11(12)14/h2-7H,8-10H2,1H3,(H,15,16).
What are the key properties of 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid?
4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid has a molecular weight of 248.28 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-2-enoxy-2,3-dihydrochromene-4-carboxylic acid is sourced from PubChem (CID 114996160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).