About N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine
N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine (PubChem CID 11499626) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 11499626 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine |
| SMILES | CCCCNc1nc2ccccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N4O2/c1-2-3-7-12-10-11(15(16)17)14-8-5-4-6-9(14)13-10/h4-6,8,12H,2-3,7H2,1H3 |
| InChIKey | BQRLGYBVJVRHPP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine?
The IUPAC name of N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine (CID 11499626) is N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine is CCCCNc1nc2ccccn2c1[N+](=O)[O-].
What is the InChIKey of N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine?
The InChIKey is BQRLGYBVJVRHPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-2-3-7-12-10-11(15(16)17)14-8-5-4-6-9(14)13-10/h4-6,8,12H,2-3,7H2,1H3.
What are the key properties of N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine?
N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine has a molecular weight of 234.26 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3-nitroimidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 11499626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).