C15H25NO — CID 11499637
N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 11499637) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 11499637 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CC(C)=CCC/C(C)=C\CNC(=O)C1CC1C |
| InChI | InChI=1S/C15H25NO/c1-11(2)6-5-7-12(3)8-9-16-15(17)14-10-13(14)4/h6,8,13-14H,5,7,9-10H2,1-4H3,(H,16,17)/b12-8- |
| InChIKey | QSCXRQNUOWERIY-WQLSENKSSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|