C12H16FN3O — CID 114996534
3-(4-aminobutylamino)-5-fluoro-1,3-dihydroindol-2-one (PubChem CID 114996534) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-(4-aminobutylamino)-5-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-(4-aminobutylamino)-5-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 114996534 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-(4-aminobutylamino)-5-fluoro-1,3-dihydroindol-2-one |
| SMILES | NCCCCNC1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C12H16FN3O/c13-8-3-4-10-9(7-8)11(12(17)16-10)15-6-2-1-5-14/h3-4,7,11,15H,1-2,5-6,14H2,(H,16,17) |
| InChIKey | DTKAZNJBZIVNRR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|