About tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate
tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate (PubChem CID 11499655) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate |
| PubChem CID | 11499655 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC=CC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C11H18N4O2/c1-11(2,3)17-10(16)13-8-6-4-5-7-9(8)14-15-12/h4-5,8-9H,6-7H2,1-3H3,(H,13,16)/t8-,9-/m0/s1 |
| InChIKey | QIPXGVMEDKYNOO-IUCAKERBSA-N |
| XLogP | 2.91 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate?
The IUPAC name of tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate (CID 11499655) is tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate?
The canonical SMILES for tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate is CC(C)(C)OC(=O)N[C@H]1CC=CC[C@@H]1N=[N+]=[N-].
What is the InChIKey of tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate?
The InChIKey is QIPXGVMEDKYNOO-IUCAKERBSA-N. The full InChI is InChI=1S/C11H18N4O2/c1-11(2,3)17-10(16)13-8-6-4-5-7-9(8)14-15-12/h4-5,8-9H,6-7H2,1-3H3,(H,13,16)/t8-,9-/m0/s1.
What are the key properties of tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate?
tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate has a molecular weight of 238.29 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S,6S)-6-azidocyclohex-3-en-1-yl]carbamate is sourced from PubChem (CID 11499655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).