About 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane
2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane (PubChem CID 11499798) has the molecular formula C14H17ClO2
and a molecular weight of 252.74 g/mol. Its IUPAC name is 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane |
| PubChem CID | 11499798 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane |
| SMILES | Clc1ccc2c(c1)CC[C@@H]2CCC1OCCO1 |
| InChI | InChI=1S/C14H17ClO2/c15-12-4-5-13-10(1-2-11(13)9-12)3-6-14-16-7-8-17-14/h4-5,9-10,14H,1-3,6-8H2/t10-/m1/s1 |
| InChIKey | PMMLACBZIFCNFP-SNVBAGLBSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane?
The IUPAC name of 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane (CID 11499798) is 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane.
What is the SMILES notation for 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane?
The canonical SMILES for 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane is Clc1ccc2c(c1)CC[C@@H]2CCC1OCCO1.
What is the InChIKey of 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane?
The InChIKey is PMMLACBZIFCNFP-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H17ClO2/c15-12-4-5-13-10(1-2-11(13)9-12)3-6-14-16-7-8-17-14/h4-5,9-10,14H,1-3,6-8H2/t10-/m1/s1.
What are the key properties of 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane?
2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane has a molecular weight of 252.74 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]ethyl]-1,3-dioxolane is sourced from PubChem (CID 11499798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).