C13H13N3O2 — CID 114997982
2-amino-N-[4-(1,3-oxazol-5-yl)phenyl]cyclopropane-1-carboxamide (PubChem CID 114997982) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-amino-N-[4-(1,3-oxazol-5-yl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-amino-N-[4-(1,3-oxazol-5-yl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 114997982 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-amino-N-[4-(1,3-oxazol-5-yl)phenyl]cyclopropane-1-carboxamide |
| SMILES | NC1CC1C(=O)Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C13H13N3O2/c14-11-5-10(11)13(17)16-9-3-1-8(2-4-9)12-6-15-7-18-12/h1-4,6-7,10-11H,5,14H2,(H,16,17) |
| InChIKey | XQPAPUVJFNVZGC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |