C7H11ClN4 — CID 114998180
3-chloro-N-methyl-N-propyl-1,2,4-triazin-5-amine (PubChem CID 114998180) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-propyl-1,2,4-triazin-5-amine.
| Compound Name | 3-chloro-N-methyl-N-propyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 114998180 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 3-chloro-N-methyl-N-propyl-1,2,4-triazin-5-amine |
| SMILES | CCCN(C)c1cnnc(Cl)n1 |
| InChI | InChI=1S/C7H11ClN4/c1-3-4-12(2)6-5-9-11-7(8)10-6/h5H,3-4H2,1-2H3 |
| InChIKey | JDQOOSQXMNHCCL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |