About (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde
(2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde (PubChem CID 11499919) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde.
Molecular Properties
| Compound Name | (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde |
| PubChem CID | 11499919 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde |
| SMILES | CO[C@H](C=O)[C@H]1[C@@H](OC)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-18-11(9-16)12-13(19-2)14(17)15(12)8-10-6-4-3-5-7-10/h3-7,9,11-13H,8H2,1-2H3/t11-,12+,13-/m1/s1 |
| InChIKey | CLTUNNCLEFNSSR-FRRDWIJNSA-N |
| XLogP | 0.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde?
The IUPAC name of (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde (CID 11499919) is (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde.
What is the SMILES notation for (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde?
The canonical SMILES for (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde is CO[C@H](C=O)[C@H]1[C@@H](OC)C(=O)N1Cc1ccccc1.
What is the InChIKey of (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde?
The InChIKey is CLTUNNCLEFNSSR-FRRDWIJNSA-N. The full InChI is InChI=1S/C14H17NO4/c1-18-11(9-16)12-13(19-2)14(17)15(12)8-10-6-4-3-5-7-10/h3-7,9,11-13H,8H2,1-2H3/t11-,12+,13-/m1/s1.
What are the key properties of (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde?
(2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde has a molecular weight of 263.29 g/mol, XLogP of 0.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2S,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-methoxyacetaldehyde is sourced from PubChem (CID 11499919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).