About 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane
2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane (PubChem CID 114999242) has the molecular formula C9H11ClN4
and a molecular weight of 210.67 g/mol. Its IUPAC name is 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane |
| PubChem CID | 114999242 |
| Molecular Formula | C9H11ClN4 |
| Molecular Weight | 210.67 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane |
| SMILES | Clc1nncc(N2CC3CCC2C3)n1 |
| InChI | InChI=1S/C9H11ClN4/c10-9-12-8(4-11-13-9)14-5-6-1-2-7(14)3-6/h4,6-7H,1-3,5H2 |
| InChIKey | QOMHEYFKKJTEDK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.67 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane?
The IUPAC name of 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane (CID 114999242) is 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane.
What is the SMILES notation for 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane?
The canonical SMILES for 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane is Clc1nncc(N2CC3CCC2C3)n1.
What is the InChIKey of 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane?
The InChIKey is QOMHEYFKKJTEDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN4/c10-9-12-8(4-11-13-9)14-5-6-1-2-7(14)3-6/h4,6-7H,1-3,5H2.
What are the key properties of 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane?
2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane has a molecular weight of 210.67 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-1,2,4-triazin-5-yl)-2-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 114999242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).