C6H4ClF4N3O — CID 115000075
3-chloro-5-(2,2,3,3-tetrafluoropropoxy)-1,2,4-triazine (PubChem CID 115000075) has the molecular formula C6H4ClF4N3O and a molecular weight of 245.56 g/mol. Its IUPAC name is 3-chloro-5-(2,2,3,3-tetrafluoropropoxy)-1,2,4-triazine.
| Compound Name | 3-chloro-5-(2,2,3,3-tetrafluoropropoxy)-1,2,4-triazine |
|---|---|
| PubChem CID | 115000075 |
| Molecular Formula | C6H4ClF4N3O |
| Molecular Weight | 245.56 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 3-chloro-5-(2,2,3,3-tetrafluoropropoxy)-1,2,4-triazine |
| SMILES | FC(F)C(F)(F)COc1cnnc(Cl)n1 |
| InChI | InChI=1S/C6H4ClF4N3O/c7-5-13-3(1-12-14-5)15-2-6(10,11)4(8)9/h1,4H,2H2 |
| InChIKey | VINXHMNTQOUICZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|