C11H23NO4 — CID 115000691
2-[2-(2-hydroxyethoxy)ethylamino]-2,4-dimethylpentanoic acid (PubChem CID 115000691) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethylamino]-2,4-dimethylpentanoic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethylamino]-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 115000691 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethylamino]-2,4-dimethylpentanoic acid |
| SMILES | CC(C)CC(C)(NCCOCCO)C(=O)O |
| InChI | InChI=1S/C11H23NO4/c1-9(2)8-11(3,10(14)15)12-4-6-16-7-5-13/h9,12-13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | MPDVAHOFBLDBAK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|