C9H13ClN4O — CID 115000770
3-chloro-5-(1-methylpiperidin-4-yl)oxy-1,2,4-triazine (PubChem CID 115000770) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 3-chloro-5-(1-methylpiperidin-4-yl)oxy-1,2,4-triazine.
| Compound Name | 3-chloro-5-(1-methylpiperidin-4-yl)oxy-1,2,4-triazine |
|---|---|
| PubChem CID | 115000770 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-chloro-5-(1-methylpiperidin-4-yl)oxy-1,2,4-triazine |
| SMILES | CN1CCC(Oc2cnnc(Cl)n2)CC1 |
| InChI | InChI=1S/C9H13ClN4O/c1-14-4-2-7(3-5-14)15-8-6-11-13-9(10)12-8/h6-7H,2-5H2,1H3 |
| InChIKey | QEEHFDQHAQMCFK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |