About 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid
2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid (PubChem CID 115000888) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid |
| PubChem CID | 115000888 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid |
| SMILES | CC=CCOC(C)(CC(C)(C)OC)C(=O)O |
| InChI | InChI=1S/C12H22O4/c1-6-7-8-16-12(4,10(13)14)9-11(2,3)15-5/h6-7H,8-9H2,1-5H3,(H,13,14) |
| InChIKey | BWABKVMLWOHVKU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid?
The IUPAC name of 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid (CID 115000888) is 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid.
What is the SMILES notation for 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid?
The canonical SMILES for 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid is CC=CCOC(C)(CC(C)(C)OC)C(=O)O.
What is the InChIKey of 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid?
The InChIKey is BWABKVMLWOHVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-6-7-8-16-12(4,10(13)14)9-11(2,3)15-5/h6-7H,8-9H2,1-5H3,(H,13,14).
What are the key properties of 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid?
2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid has a molecular weight of 230.30 g/mol, XLogP of 2.24, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-2-enoxy-4-methoxy-2,4-dimethylpentanoic acid is sourced from PubChem (CID 115000888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).