About ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate
ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate (PubChem CID 11500151) has the molecular formula C12H13NO7
and a molecular weight of 283.24 g/mol. Its IUPAC name is ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate.
Molecular Properties
| Compound Name | ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate |
| PubChem CID | 11500151 |
| Molecular Formula | C12H13NO7 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate |
| SMILES | CCOC(=O)Oc1cccc2c1OCC(O[N+](=O)[O-])C2 |
| InChI | InChI=1S/C12H13NO7/c1-2-17-12(14)19-10-5-3-4-8-6-9(20-13(15)16)7-18-11(8)10/h3-5,9H,2,6-7H2,1H3 |
| InChIKey | YOMIWUVUEBJRFQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate?
The IUPAC name of ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate (CID 11500151) is ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate.
What is the SMILES notation for ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate?
The canonical SMILES for ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate is CCOC(=O)Oc1cccc2c1OCC(O[N+](=O)[O-])C2.
What is the InChIKey of ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate?
The InChIKey is YOMIWUVUEBJRFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO7/c1-2-17-12(14)19-10-5-3-4-8-6-9(20-13(15)16)7-18-11(8)10/h3-5,9H,2,6-7H2,1H3.
What are the key properties of ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate?
ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate has a molecular weight of 283.24 g/mol, XLogP of 1.73, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3-nitrooxy-3,4-dihydro-2H-chromen-8-yl) carbonate is sourced from PubChem (CID 11500151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).