C15H25O3P — CID 11500170
(3E,7E,9E)-11-diethoxyphosphorylundeca-1,3,7,9-tetraene (PubChem CID 11500170) has the molecular formula C15H25O3P and a molecular weight of 284.34 g/mol. Its IUPAC name is (3E,7E,9E)-11-diethoxyphosphorylundeca-1,3,7,9-tetraene.
| Compound Name | (3E,7E,9E)-11-diethoxyphosphorylundeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 11500170 |
| Molecular Formula | C15H25O3P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (3E,7E,9E)-11-diethoxyphosphorylundeca-1,3,7,9-tetraene |
| SMILES | C=C/C=C/CC/C=C/C=C/CP(=O)(OCC)OCC |
| InChI | InChI=1S/C15H25O3P/c1-4-7-8-9-10-11-12-13-14-15-19(16,17-5-2)18-6-3/h4,7-8,11-14H,1,5-6,9-10,15H2,2-3H3/b8-7+,12-11+,14-13+ |
| InChIKey | XDJQMIBUBNYFQY-OOFIKVKXSA-N |
| XLogP | 4.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|