C13H19NO3 — CID 115001950
2-(N,3-dimethylanilino)-3-methoxy-2-methylpropanoic acid (PubChem CID 115001950) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(N,3-dimethylanilino)-3-methoxy-2-methylpropanoic acid.
| Compound Name | 2-(N,3-dimethylanilino)-3-methoxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 115001950 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-(N,3-dimethylanilino)-3-methoxy-2-methylpropanoic acid |
| SMILES | COCC(C)(C(=O)O)N(C)c1cccc(C)c1 |
| InChI | InChI=1S/C13H19NO3/c1-10-6-5-7-11(8-10)14(3)13(2,9-17-4)12(15)16/h5-8H,9H2,1-4H3,(H,15,16) |
| InChIKey | WADTUHPXXYXJIH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |