C19H17N3 — CID 11500212
(2S,5R)-1-benzhydrylpyrrolidine-2,5-dicarbonitrile (PubChem CID 11500212) has the molecular formula C19H17N3 and a molecular weight of 287.37 g/mol. Its IUPAC name is (2S,5R)-1-benzhydrylpyrrolidine-2,5-dicarbonitrile.
| Compound Name | (2S,5R)-1-benzhydrylpyrrolidine-2,5-dicarbonitrile |
|---|---|
| PubChem CID | 11500212 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (2S,5R)-1-benzhydrylpyrrolidine-2,5-dicarbonitrile |
| SMILES | N#C[C@@H]1CC[C@H](C#N)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N3/c20-13-17-11-12-18(14-21)22(17)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-19H,11-12H2/t17-,18+ |
| InChIKey | SPPLNZZXQWKXKX-HDICACEKSA-N |
| XLogP | 3.66 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |