C14H21NO2 — CID 115002126
[3-[2-(aminomethyl)cyclohexyl]oxyphenyl]methanol (PubChem CID 115002126) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is [3-[2-(aminomethyl)cyclohexyl]oxyphenyl]methanol.
| Compound Name | [3-[2-(aminomethyl)cyclohexyl]oxyphenyl]methanol |
|---|---|
| PubChem CID | 115002126 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | [3-[2-(aminomethyl)cyclohexyl]oxyphenyl]methanol |
| SMILES | NCC1CCCCC1Oc1cccc(CO)c1 |
| InChI | InChI=1S/C14H21NO2/c15-9-12-5-1-2-7-14(12)17-13-6-3-4-11(8-13)10-16/h3-4,6,8,12,14,16H,1-2,5,7,9-10,15H2 |
| InChIKey | UJCOFVDWZLECJL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |