C13H10N2O5S — CID 11500487
2-(9-amino-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetic acid (PubChem CID 11500487) has the molecular formula C13H10N2O5S and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-(9-amino-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetic acid.
| Compound Name | 2-(9-amino-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 11500487 |
| Molecular Formula | C13H10N2O5S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-(9-amino-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetic acid |
| SMILES | Nc1cccc2ccc3c(c12)C(=O)N(CC(=O)O)S3(=O)=O |
| InChI | InChI=1S/C13H10N2O5S/c14-8-3-1-2-7-4-5-9-12(11(7)8)13(18)15(6-10(16)17)21(9,19)20/h1-5H,6,14H2,(H,16,17) |
| InChIKey | RRBWWXCDDOIRQG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|