C13H19NO4 — CID 115005268
N-[[4-methoxy-3-(oxan-3-yloxy)phenyl]methyl]hydroxylamine (PubChem CID 115005268) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-[[4-methoxy-3-(oxan-3-yloxy)phenyl]methyl]hydroxylamine.
| Compound Name | N-[[4-methoxy-3-(oxan-3-yloxy)phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 115005268 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-[[4-methoxy-3-(oxan-3-yloxy)phenyl]methyl]hydroxylamine |
| SMILES | COc1ccc(CNO)cc1OC1CCCOC1 |
| InChI | InChI=1S/C13H19NO4/c1-16-12-5-4-10(8-14-15)7-13(12)18-11-3-2-6-17-9-11/h4-5,7,11,14-15H,2-3,6,8-9H2,1H3 |
| InChIKey | PBXARGGBBXJZHK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|