About 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid
7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid (PubChem CID 115007759) has the molecular formula C11H8N2O3
and a molecular weight of 216.20 g/mol. Its IUPAC name is 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid |
| PubChem CID | 115007759 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c([nH]1)[nH]c1ccc(O)cc12 |
| InChI | InChI=1S/C11H8N2O3/c14-5-1-2-8-6(3-5)7-4-9(11(15)16)13-10(7)12-8/h1-4,12-14H,(H,15,16) |
| InChIKey | HHEDQVDSHSDDHM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid?
The IUPAC name of 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid (CID 115007759) is 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid.
What is the SMILES notation for 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid?
The canonical SMILES for 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid is O=C(O)c1cc2c([nH]1)[nH]c1ccc(O)cc12.
What is the InChIKey of 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid?
The InChIKey is HHEDQVDSHSDDHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O3/c14-5-1-2-8-6(3-5)7-4-9(11(15)16)13-10(7)12-8/h1-4,12-14H,(H,15,16).
What are the key properties of 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid?
7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid has a molecular weight of 216.20 g/mol, XLogP of 2.05, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylic acid is sourced from PubChem (CID 115007759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).