C13H11NO3 — CID 115007766
7-methoxy-3-methyl-[1]benzofuro[2,3-b]pyrrole-2-carbaldehyde (PubChem CID 115007766) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 7-methoxy-3-methyl-[1]benzofuro[2,3-b]pyrrole-2-carbaldehyde.
| Compound Name | 7-methoxy-3-methyl-[1]benzofuro[2,3-b]pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 115007766 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 7-methoxy-3-methyl-[1]benzofuro[2,3-b]pyrrole-2-carbaldehyde |
| SMILES | COc1ccc2oc3c(cc(C=O)n3C)c2c1 |
| InChI | InChI=1S/C13H11NO3/c1-14-8(7-15)5-11-10-6-9(16-2)3-4-12(10)17-13(11)14/h3-7H,1-2H3 |
| InChIKey | FGHZEZLRXPKPLU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|